Products 1794979-83-1
CAS 1794979-83-1 appears in our catalog under these names: 2-(4-Isobutylphenyl)propan-3,3,3-d3-1-ol, Ibuprofen-d3 Alcohol. Offered by: MedChemExpress, TRC, Biosynth. Available pack sizes: 50 mg, 1 mg, 1mg, 50mg, 2mg, 5mg, 25mg, 10mg.
3,3,3-trideuterio-2-[4-(2-methylpropyl)phenyl]propan-1-ol (CAS 1794979-83-1) is a chemical compound with the molecular formula C13H20O and a molecular weight of 195.32 g/mol. IUPAC name: 3,3,3-trideuterio-2-[4-(2-methylpropyl)phenyl]propan-1-ol. InChIKey: IZXWIWYERZDWOA-HPRDVNIFSA-N.
| Molecular formula | C13H20O |
|---|---|
| Molecular weight | 195.32 g/mol |
| IUPAC name | 3,3,3-trideuterio-2-[4-(2-methylpropyl)phenyl]propan-1-ol |
| InChIKey | IZXWIWYERZDWOA-HPRDVNIFSA-N |
| SMILES | [2H]C([2H])([2H])C(CO)C1=CC=C(C=C1)CC(C)C |
Computed by PubChem (NCBI)
Synonyms:
Ibuprofen-d3 Alcohol