CAS 17950-40-2 appears in our catalog under these names: Triethyloxonium hexafluorophosphate, TRIETHYLOXONIUM HEXAFLUOROPHOSPHATE, CO&. Offered by: GLPBio, Sigma-Aldrich. Available pack sizes: 5g, 25G.
Triethyloxidanium hexafluorophosphate (CAS 17950-40-2) is a chemical compound with the molecular formula C6H15F6OP and a molecular weight of 248.15 g/mol. IUPAC name: triethyloxidanium hexafluorophosphate. InChIKey: JRHIFBONIQGZFC-UHFFFAOYSA-N.
| Molecular formula | C6H15F6OP |
|---|---|
| Molecular weight | 248.15 g/mol |
| IUPAC name | triethyloxidanium hexafluorophosphate |
| InChIKey | JRHIFBONIQGZFC-UHFFFAOYSA-N |
| SMILES | CC[O+](CC)CC.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)