CAS 1795011-67-4 is the registry number for 2-Bromo-2-(2-chlorophenyl)cyclohexanol-d4. Offered by: TRC. Available pack sizes: 50mg, 5mg.
2-bromo-2-(2-chloro-3,4,5,6-tetradeuteriophenyl)cyclohexan-1-ol (CAS 1795011-67-4) is a chemical compound with the molecular formula C12H14BrClO and a molecular weight of 293.62 g/mol. IUPAC name: 2-bromo-2-(2-chloro-3,4,5,6-tetradeuteriophenyl)cyclohexan-1-ol. InChIKey: OZDHYLYJRGYGEB-NMRLXUNGSA-N.
| Molecular formula | C12H14BrClO |
|---|---|
| Molecular weight | 293.62 g/mol |
| IUPAC name | 2-bromo-2-(2-chloro-3,4,5,6-tetradeuteriophenyl)cyclohexan-1-ol |
| InChIKey | OZDHYLYJRGYGEB-NMRLXUNGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C2(CCCCC2O)Br)Cl)[2H])[2H] |
Computed by PubChem (NCBI)