Products 1795011-78-7
CAS 1795011-78-7 is the registry number for 1-Bromo-3-methylbutane-d7. Offered by: TRC. Available pack sizes: 250mg, 25mg.
4-bromo-1,1,1,2-tetradeuterio-2-(trideuteriomethyl)butane (CAS 1795011-78-7) is a chemical compound with the molecular formula C5H11Br and a molecular weight of 158.09 g/mol. IUPAC name: 4-bromo-1,1,1,2-tetradeuterio-2-(trideuteriomethyl)butane. InChIKey: YXZFFTJAHVMMLF-TXVPSQRDSA-N.
| Molecular formula | C5H11Br |
|---|---|
| Molecular weight | 158.09 g/mol |
| IUPAC name | 4-bromo-1,1,1,2-tetradeuterio-2-(trideuteriomethyl)butane |
| InChIKey | YXZFFTJAHVMMLF-TXVPSQRDSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(CCBr)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)