CAS 1795135-24-8 is the registry number for Clovoxamine Maleate Salt(E/Z-Mixture). Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
(Z)-but-2-enedioic acid;2-[(E)-[1-(4-chlorophenyl)-5-methoxypentylidene]amino]oxyethanamine (CAS 1795135-24-8) is a chemical compound with the molecular formula C18H25ClN2O6 and a molecular weight of 400.9 g/mol. IUPAC name: (Z)-but-2-enedioic acid;2-[(E)-[1-(4-chlorophenyl)-5-methoxypentylidene]amino]oxyethanamine. InChIKey: HOFGGHPYWKSXTN-DRFVMBSJSA-N.
| Molecular formula | C18H25ClN2O6 |
|---|---|
| Molecular weight | 400.9 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;2-[(E)-[1-(4-chlorophenyl)-5-methoxypentylidene]amino]oxyethanamine |
| InChIKey | HOFGGHPYWKSXTN-DRFVMBSJSA-N |
| SMILES | COCCCC/C(=N\OCCN)/C1=CC=C(C=C1)Cl.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)