Products 1795136-77-4
CAS 1795136-77-4 appears in our catalog under these names: Monocrotophos-d6, Monocrotophos-d6 (Major), >95% (HPLC). Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 2.5 mg, 25 mg.
[(E)-4-(methylamino)-4-oxobut-2-en-2-yl] bis(trideuteriomethyl) phosphate (CAS 1795136-77-4) is a chemical compound with the molecular formula C7H14NO5P and a molecular weight of 229.20 g/mol. IUPAC name: [(E)-4-(methylamino)-4-oxobut-2-en-2-yl] bis(trideuteriomethyl) phosphate. InChIKey: KRTSDMXIXPKRQR-DMEHDTLASA-N.
| Molecular formula | C7H14NO5P |
|---|---|
| Molecular weight | 229.20 g/mol |
| IUPAC name | [(E)-4-(methylamino)-4-oxobut-2-en-2-yl] bis(trideuteriomethyl) phosphate |
| InChIKey | KRTSDMXIXPKRQR-DMEHDTLASA-N |
| SMILES | [2H]C([2H])([2H])OP(=O)(O/C(=C/C(=O)NC)/C)OC([2H])([2H])[2H] |
Computed by PubChem (NCBI)