Products 1795143-63-3
CAS 1795143-63-3 is the registry number for Glycidyl Eicosapentaenoate-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
[dideuterio-(2,3,3-trideuteriooxiran-2-yl)methyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate (CAS 1795143-63-3) is a chemical compound with the molecular formula C23H34O3 and a molecular weight of 363.5 g/mol. IUPAC name: [dideuterio-(2,3,3-trideuteriooxiran-2-yl)methyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate. InChIKey: INTHOQCNXQLKIE-QOWHZJMFSA-N.
| Molecular formula | C23H34O3 |
|---|---|
| Molecular weight | 363.5 g/mol |
| IUPAC name | [dideuterio-(2,3,3-trideuteriooxiran-2-yl)methyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate |
| InChIKey | INTHOQCNXQLKIE-QOWHZJMFSA-N |
| SMILES | [2H]C1(C(O1)([2H])C([2H])([2H])OC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC)[2H] |
Computed by PubChem (NCBI)
Synonyms:
Glycidyl Eicosapentaenoate-d5