CAS 179538-97-7 appears in our catalog under these names: Ethyl 2-(trifluoromethyl sulfonyloxy) benzoate, 97%, Ethyl 2-(((trifluoromethyl)sulfonyl)oxy)benzoate, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 1g.
Ethyl 2-(trifluoromethylsulfonyloxy)benzoate (CAS 179538-97-7) is a chemical compound with the molecular formula C10H9F3O5S and a molecular weight of 298.24 g/mol. IUPAC name: ethyl 2-(trifluoromethylsulfonyloxy)benzoate. InChIKey: VDPKUXGAEQOPME-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O5S |
|---|---|
| Molecular weight | 298.24 g/mol |
| IUPAC name | ethyl 2-(trifluoromethylsulfonyloxy)benzoate |
| InChIKey | VDPKUXGAEQOPME-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=CC=C1OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)