CAS 1795429-46-7 is the registry number for FFK29. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-benzyl-N-methyl-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide (CAS 1795429-46-7) is a chemical compound with the molecular formula C18H14F3N3O2 and a molecular weight of 361.3 g/mol. IUPAC name: N-benzyl-N-methyl-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide. InChIKey: YAVLOLUBQRHBBR-UHFFFAOYSA-N.
| Molecular formula | C18H14F3N3O2 |
|---|---|
| Molecular weight | 361.3 g/mol |
| IUPAC name | N-benzyl-N-methyl-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide |
| InChIKey | YAVLOLUBQRHBBR-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC=CC=C1)C(=O)C2=CC=C(C=C2)C3=NOC(=N3)C(F)(F)F |
Computed by PubChem (NCBI)