Products 1795433-82-7

CAS 1795433-82-7 is the registry number for tert-Butyl 2-{(1-(ethanesulfonyl)piperidin-4-yl)amino}acetate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl 2-[(1-ethylsulfonylpiperidin-4-yl)amino]acetate (CAS 1795433-82-7) is a chemical compound with the molecular formula C13H26N2O4S and a molecular weight of 306.42 g/mol. IUPAC name: tert-butyl 2-[(1-ethylsulfonylpiperidin-4-yl)amino]acetate. InChIKey: NDKUZFNQRXBRHA-UHFFFAOYSA-N.

Identity
Molecular formulaC13H26N2O4S
Molecular weight306.42 g/mol
IUPAC nametert-butyl 2-[(1-ethylsulfonylpiperidin-4-yl)amino]acetate
InChIKeyNDKUZFNQRXBRHA-UHFFFAOYSA-N
SMILESCCS(=O)(=O)N1CCC(CC1)NCC(=O)OC(C)(C)C

Computed by PubChem (NCBI)