Products 1795515-80-8
CAS 1795515-80-8 is the registry number for 6-(3-(4-Methoxyphenyl)-1H-pyrazol-1-yl)pyridazine-3-thiol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-[3-(4-methoxyphenyl)pyrazol-1-yl]-1H-pyridazine-6-thione (CAS 1795515-80-8) is a chemical compound with the molecular formula C14H12N4OS and a molecular weight of 284.34 g/mol. IUPAC name: 3-[3-(4-methoxyphenyl)pyrazol-1-yl]-1H-pyridazine-6-thione. InChIKey: IKXFDRQAEQLACW-UHFFFAOYSA-N.
| Molecular formula | C14H12N4OS |
|---|---|
| Molecular weight | 284.34 g/mol |
| IUPAC name | 3-[3-(4-methoxyphenyl)pyrazol-1-yl]-1H-pyridazine-6-thione |
| InChIKey | IKXFDRQAEQLACW-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NN(C=C2)C3=NNC(=S)C=C3 |
Computed by PubChem (NCBI)