Products 1795786-79-6
CAS 1795786-79-6 appears in our catalog under these names: Penicillamine Impurity 4(L-Penicillamine-d6), L-Penicillamine-d6. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
(2R)-2-amino-4,4,4-trideuterio-3-sulfanyl-3-(trideuteriomethyl)butanoic acid (CAS 1795786-79-6) is a chemical compound with the molecular formula C5H11NO2S and a molecular weight of 155.25 g/mol. IUPAC name: (2R)-2-amino-4,4,4-trideuterio-3-sulfanyl-3-(trideuteriomethyl)butanoic acid. InChIKey: VVNCNSJFMMFHPL-CWJIZBONSA-N.
| Molecular formula | C5H11NO2S |
|---|---|
| Molecular weight | 155.25 g/mol |
| IUPAC name | (2R)-2-amino-4,4,4-trideuterio-3-sulfanyl-3-(trideuteriomethyl)butanoic acid |
| InChIKey | VVNCNSJFMMFHPL-CWJIZBONSA-N |
| SMILES | [2H]C([2H])([2H])C([C@@H](C(=O)O)N)(C([2H])([2H])[2H])S |
Computed by PubChem (NCBI)