CAS 1795939-94-4 is the registry number for 2,2,2-Trifluoro-N-{2-[(2-fluorophenyl)formamido]ethyl}acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-fluoro-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]benzamide (CAS 1795939-94-4) is a chemical compound with the molecular formula C11H10F4N2O2 and a molecular weight of 278.20 g/mol. IUPAC name: 2-fluoro-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]benzamide. InChIKey: HXGAFEQQKFMICB-UHFFFAOYSA-N.
| Molecular formula | C11H10F4N2O2 |
|---|---|
| Molecular weight | 278.20 g/mol |
| IUPAC name | 2-fluoro-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]benzamide |
| InChIKey | HXGAFEQQKFMICB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NCCNC(=O)C(F)(F)F)F |
Computed by PubChem (NCBI)