CAS 17961-81-8 is the registry number for (2,5-Dimethylphenyl)trimethylsilane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2,5-dimethylphenyl)-trimethylsilane (CAS 17961-81-8) is a chemical compound with the molecular formula C11H18Si and a molecular weight of 178.35 g/mol. IUPAC name: (2,5-dimethylphenyl)-trimethylsilane. InChIKey: IMFHQSPTADSSAO-UHFFFAOYSA-N.
| Molecular formula | C11H18Si |
|---|---|
| Molecular weight | 178.35 g/mol |
| IUPAC name | (2,5-dimethylphenyl)-trimethylsilane |
| InChIKey | IMFHQSPTADSSAO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)[Si](C)(C)C |
Computed by PubChem (NCBI)