CAS 17962-31-1 is the registry number for 2,2,4,4,6-Pentamethyl-6-phenylcyclotrisiloxane. Offered by: TRC. Available pack sizes: 250mg.
2,2,4,4,6-pentamethyl-6-phenyl-1,3,5,2,4,6-trioxatrisilinane (CAS 17962-31-1) is a chemical compound with the molecular formula C11H20O3Si3 and a molecular weight of 284.53 g/mol. IUPAC name: 2,2,4,4,6-pentamethyl-6-phenyl-1,3,5,2,4,6-trioxatrisilinane. InChIKey: JITAAWJDVCUJPO-UHFFFAOYSA-N.
| Molecular formula | C11H20O3Si3 |
|---|---|
| Molecular weight | 284.53 g/mol |
| IUPAC name | 2,2,4,4,6-pentamethyl-6-phenyl-1,3,5,2,4,6-trioxatrisilinane |
| InChIKey | JITAAWJDVCUJPO-UHFFFAOYSA-N |
| SMILES | C[Si]1(O[Si](O[Si](O1)(C)C2=CC=CC=C2)(C)C)C |
Computed by PubChem (NCBI)