Products 1796602-13-5
CAS 1796602-13-5 is the registry number for m-Toluoyl-d7 Chloride. Offered by: TRC. Available pack sizes: 25mg.
2,3,4,6-tetradeuterio-5-(trideuteriomethyl)benzoyl chloride (CAS 1796602-13-5) is a chemical compound with the molecular formula C8H7ClO and a molecular weight of 161.63 g/mol. IUPAC name: 2,3,4,6-tetradeuterio-5-(trideuteriomethyl)benzoyl chloride. InChIKey: YHOYYHYBFSYOSQ-AAYPNNLASA-N.
| Molecular formula | C8H7ClO |
|---|---|
| Molecular weight | 161.63 g/mol |
| IUPAC name | 2,3,4,6-tetradeuterio-5-(trideuteriomethyl)benzoyl chloride |
| InChIKey | YHOYYHYBFSYOSQ-AAYPNNLASA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)Cl)[2H])C([2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
m-Toluoyl-d7 Chloride