CAS 1796928-60-3 is the registry number for 6,8-Dibromo-1,2,3,4-tetrahydro-3-methyl-quinazoline Hydrochloride. Offered by: TRC. Available pack sizes: 100mg, 1g.
6,8-dibromo-3-methyl-2,4-dihydro-1H-quinazoline;hydrochloride (CAS 1796928-60-3) is a chemical compound with the molecular formula C9H11Br2ClN2 and a molecular weight of 342.46 g/mol. IUPAC name: 6,8-dibromo-3-methyl-2,4-dihydro-1H-quinazoline;hydrochloride. InChIKey: UXRKBGKQTJQYPV-UHFFFAOYSA-N.
| Molecular formula | C9H11Br2ClN2 |
|---|---|
| Molecular weight | 342.46 g/mol |
| IUPAC name | 6,8-dibromo-3-methyl-2,4-dihydro-1H-quinazoline;hydrochloride |
| InChIKey | UXRKBGKQTJQYPV-UHFFFAOYSA-N |
| SMILES | CN1CC2=C(C(=CC(=C2)Br)Br)NC1.Cl |
Computed by PubChem (NCBI)