CAS 1796963-99-9 is the registry number for 2-Amino-4-(4-(6-tert-butyl-1,1-dimethylindane))thiazole. Offered by: Biosynth. Available pack sizes: 2000mg, 1000mg.
4-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)-1,3-thiazol-2-amine (CAS 1796963-99-9) is a chemical compound with the molecular formula C18H24N2S and a molecular weight of 300.5 g/mol. IUPAC name: 4-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)-1,3-thiazol-2-amine. InChIKey: OMHPPGJSDNIYFI-UHFFFAOYSA-N.
| Molecular formula | C18H24N2S |
|---|---|
| Molecular weight | 300.5 g/mol |
| IUPAC name | 4-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)-1,3-thiazol-2-amine |
| InChIKey | OMHPPGJSDNIYFI-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C(C=C(C=C21)C(C)(C)C)C3=CSC(=N3)N)C |
Computed by PubChem (NCBI)