CAS 1796964-23-2 is the registry number for Methyl 4-(N-(2-(5-cyclopropyl-3-(pyridin-2-yl)-1H-pyrazol-1-yl)ethyl)sulfamoyl)benzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-[2-(5-cyclopropyl-3-pyridin-2-ylpyrazol-1-yl)ethylsulfamoyl]benzoate (CAS 1796964-23-2) is a chemical compound with the molecular formula C21H22N4O4S and a molecular weight of 426.5 g/mol. IUPAC name: methyl 4-[2-(5-cyclopropyl-3-pyridin-2-ylpyrazol-1-yl)ethylsulfamoyl]benzoate. InChIKey: VKDHGMUJYBMGPT-UHFFFAOYSA-N.
| Molecular formula | C21H22N4O4S |
|---|---|
| Molecular weight | 426.5 g/mol |
| IUPAC name | methyl 4-[2-(5-cyclopropyl-3-pyridin-2-ylpyrazol-1-yl)ethylsulfamoyl]benzoate |
| InChIKey | VKDHGMUJYBMGPT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)S(=O)(=O)NCCN2C(=CC(=N2)C3=CC=CC=N3)C4CC4 |
Computed by PubChem (NCBI)