Products 1797001-98-9
CAS 1797001-98-9 is the registry number for tert-butyl N-{4-[5-(methylsulfanyl)-1,3,4-oxadiazol-2-yl]phenyl}carbamate. Offered by: Chemat. Available pack sizes: 100mg.
Tert-butyl N-[4-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)phenyl]carbamate (CAS 1797001-98-9) is a chemical compound with the molecular formula C14H17N3O3S and a molecular weight of 307.37 g/mol. IUPAC name: tert-butyl N-[4-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)phenyl]carbamate. InChIKey: BLSKFHGFCVZQGL-UHFFFAOYSA-N.
| Molecular formula | C14H17N3O3S |
|---|---|
| Molecular weight | 307.37 g/mol |
| IUPAC name | tert-butyl N-[4-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)phenyl]carbamate |
| InChIKey | BLSKFHGFCVZQGL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=C(C=C1)C2=NN=C(O2)SC |
Computed by PubChem (NCBI)