CAS 1797066-35-3 is the registry number for 2-(3-Bromophenyl)-1-(1,4-diazepan-1-yl)ethan-1-one hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-bromophenyl)-1-(1,4-diazepan-1-yl)ethanone;hydrochloride (CAS 1797066-35-3) is a chemical compound with the molecular formula C13H18BrClN2O and a molecular weight of 333.65 g/mol. IUPAC name: 2-(3-bromophenyl)-1-(1,4-diazepan-1-yl)ethanone;hydrochloride. InChIKey: PQAUEZPTLREDCW-UHFFFAOYSA-N.
| Molecular formula | C13H18BrClN2O |
|---|---|
| Molecular weight | 333.65 g/mol |
| IUPAC name | 2-(3-bromophenyl)-1-(1,4-diazepan-1-yl)ethanone;hydrochloride |
| InChIKey | PQAUEZPTLREDCW-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)C(=O)CC2=CC(=CC=C2)Br.Cl |
Computed by PubChem (NCBI)