CAS 1797102-40-9 is the registry number for 4-O-tert-Butyldimethylsilyl-2,3-dihydroxy-2-methyl-butan-1,4-diol 1-O-Benzyl Ester. Offered by: TRC. Available pack sizes: 100mg, 10mg.
(2S,3R)-5-[tert-butyl(dimethyl)silyl]-2-methyl-1-phenylmethoxypentane-2,3-diol (CAS 1797102-40-9) is a chemical compound with the molecular formula C19H34O3Si and a molecular weight of 338.6 g/mol. IUPAC name: (2S,3R)-5-[tert-butyl(dimethyl)silyl]-2-methyl-1-phenylmethoxypentane-2,3-diol. InChIKey: PCOUEAYVMJKXAH-MJGOQNOKSA-N.
| Molecular formula | C19H34O3Si |
|---|---|
| Molecular weight | 338.6 g/mol |
| IUPAC name | (2S,3R)-5-[tert-butyl(dimethyl)silyl]-2-methyl-1-phenylmethoxypentane-2,3-diol |
| InChIKey | PCOUEAYVMJKXAH-MJGOQNOKSA-N |
| SMILES | C[C@](COCC1=CC=CC=C1)([C@@H](CC[Si](C)(C)C(C)(C)C)O)O |
Computed by PubChem (NCBI)