CAS 1797131-50-0 appears in our catalog under these names: Haloperidoli Decanoas EP Impurity F, Haloperidol Decanoate Impurity 6(Haloperidol Decanoate EP Impurity F), 4-Dechloro-4-(3-chlorophenyl) Haloperidol Decanoate, >95% (HPLC), 4-Dechloro-4-(3-chlorophenyl) haloperidol decanoate-d19, Haloperidol impurity 12. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 2mg.
[4-[4-(3-chlorophenyl)phenyl]-1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl] decanoate (CAS 1797131-50-0) is a chemical compound with the molecular formula C37H45ClFNO3 and a molecular weight of 606.2 g/mol. IUPAC name: [4-[4-(3-chlorophenyl)phenyl]-1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl] decanoate. InChIKey: HFVLKYOQUAWMSA-UHFFFAOYSA-N.
| Molecular formula | C37H45ClFNO3 |
|---|---|
| Molecular weight | 606.2 g/mol |
| IUPAC name | [4-[4-(3-chlorophenyl)phenyl]-1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl] decanoate |
| InChIKey | HFVLKYOQUAWMSA-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(=O)OC1(CCN(CC1)CCCC(=O)C2=CC=C(C=C2)F)C3=CC=C(C=C3)C4=CC(=CC=C4)Cl |
Computed by PubChem (NCBI)