CAS 1797227-23-6 is the registry number for 6-Acetyloxy-3-methoxy-11,12-dihydro-benzopyrene. Offered by: TRC. Available pack sizes: 10mg, 1mg.
(3-methoxy-11,12-dihydrobenzo[b]pyren-6-yl) acetate (CAS 1797227-23-6) is a chemical compound with the molecular formula C23H18O3 and a molecular weight of 342.4 g/mol. IUPAC name: (3-methoxy-11,12-dihydrobenzo[b]pyren-6-yl) acetate. InChIKey: OTDRHXVWRASEGQ-UHFFFAOYSA-N.
| Molecular formula | C23H18O3 |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | (3-methoxy-11,12-dihydrobenzo[b]pyren-6-yl) acetate |
| InChIKey | OTDRHXVWRASEGQ-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C2C=CC3=C(C=CC4=C3C2=C(CC4)C5=CC=CC=C51)OC |
Computed by PubChem (NCBI)