CAS 1797296-39-9 is the registry number for 4-(3-(Trifluoromethyl)phenoxy)phenylthiourea. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
[4-[3-(trifluoromethyl)phenoxy]phenyl]thiourea (CAS 1797296-39-9) is a chemical compound with the molecular formula C14H11F3N2OS and a molecular weight of 312.31 g/mol. IUPAC name: [4-[3-(trifluoromethyl)phenoxy]phenyl]thiourea. InChIKey: LEMVAUBCSCYVMI-UHFFFAOYSA-N.
| Molecular formula | C14H11F3N2OS |
|---|---|
| Molecular weight | 312.31 g/mol |
| IUPAC name | [4-[3-(trifluoromethyl)phenoxy]phenyl]thiourea |
| InChIKey | LEMVAUBCSCYVMI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC2=CC=C(C=C2)NC(=S)N)C(F)(F)F |
Computed by PubChem (NCBI)