CAS 1797296-60-6 is the registry number for 2-(2,5-Dichlorobenzenesulphonyl)propionic acid hydrazide. Offered by: Biosynth. Available pack sizes: 5000mg, 10000mg.
2-(2,5-dichlorophenyl)sulfonylpropanehydrazide (CAS 1797296-60-6) is a chemical compound with the molecular formula C9H10Cl2N2O3S and a molecular weight of 297.16 g/mol. IUPAC name: 2-(2,5-dichlorophenyl)sulfonylpropanehydrazide. InChIKey: BONIBBMLJFXWJZ-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2N2O3S |
|---|---|
| Molecular weight | 297.16 g/mol |
| IUPAC name | 2-(2,5-dichlorophenyl)sulfonylpropanehydrazide |
| InChIKey | BONIBBMLJFXWJZ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NN)S(=O)(=O)C1=C(C=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)