CAS 1797363-25-7 is the registry number for 5-Bromo-4,6-dimethylpyrimidin-2-ylthiourea. Offered by: Biosynth. Available pack sizes: 5000mg.
(5-bromo-4,6-dimethylpyrimidin-2-yl)thiourea (CAS 1797363-25-7) is a chemical compound with the molecular formula C7H9BrN4S and a molecular weight of 261.14 g/mol. IUPAC name: (5-bromo-4,6-dimethylpyrimidin-2-yl)thiourea. InChIKey: JLJRPVVVTDWDSD-UHFFFAOYSA-N.
| Molecular formula | C7H9BrN4S |
|---|---|
| Molecular weight | 261.14 g/mol |
| IUPAC name | (5-bromo-4,6-dimethylpyrimidin-2-yl)thiourea |
| InChIKey | JLJRPVVVTDWDSD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=N1)NC(=S)N)C)Br |
Computed by PubChem (NCBI)