Products 1797399-64-4
CAS 1797399-64-4 is the registry number for 4-Acetyloxy-N-despropyl ropivacaine. Offered by: Biosynth. Available pack sizes: 100mg.
[3,5-dimethyl-4-[[(2S)-piperidine-2-carbonyl]amino]phenyl] acetate (CAS 1797399-64-4) is a chemical compound with the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. IUPAC name: [3,5-dimethyl-4-[[(2S)-piperidine-2-carbonyl]amino]phenyl] acetate. InChIKey: YGYZVGXQFIWYLW-AWEZNQCLSA-N.
| Molecular formula | C16H22N2O3 |
|---|---|
| Molecular weight | 290.36 g/mol |
| IUPAC name | [3,5-dimethyl-4-[[(2S)-piperidine-2-carbonyl]amino]phenyl] acetate |
| InChIKey | YGYZVGXQFIWYLW-AWEZNQCLSA-N |
| SMILES | CC1=CC(=CC(=C1NC(=O)[C@@H]2CCCCN2)C)OC(=O)C |
Computed by PubChem (NCBI)