CAS 1797558-60-1 is the registry number for (1H-Indol-7-yl)methanamine hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
1H-indol-7-ylmethanamine;hydrochloride (CAS 1797558-60-1) is a chemical compound with the molecular formula C9H11ClN2 and a molecular weight of 182.65 g/mol. IUPAC name: 1H-indol-7-ylmethanamine;hydrochloride. InChIKey: BSVVFOVYLWIWRF-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2 |
|---|---|
| Molecular weight | 182.65 g/mol |
| IUPAC name | 1H-indol-7-ylmethanamine;hydrochloride |
| InChIKey | BSVVFOVYLWIWRF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)CN)NC=C2.Cl |
Computed by PubChem (NCBI)