Products 179763-60-1
CAS 179763-60-1 is the registry number for 3-((2-(4-Azidobenzamido)ethyl)disulfanyl)propanoic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[2-[(4-azidobenzoyl)amino]ethyldisulfanyl]propanoic acid (CAS 179763-60-1) is a chemical compound with the molecular formula C12H14N4O3S2 and a molecular weight of 326.4 g/mol. IUPAC name: 3-[2-[(4-azidobenzoyl)amino]ethyldisulfanyl]propanoic acid. InChIKey: RYBZBRJREAWBJE-UHFFFAOYSA-N.
| Molecular formula | C12H14N4O3S2 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 3-[2-[(4-azidobenzoyl)amino]ethyldisulfanyl]propanoic acid |
| InChIKey | RYBZBRJREAWBJE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NCCSSCCC(=O)O)N=[N+]=[N-] |
Computed by PubChem (NCBI)