CAS 1797817-35-6 is the registry number for 2-Azahypoxanthine Sodium Salt. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 1g, 1000mg, 500mg.
Sodium 5H-imidazo[4,5-d]triazin-4-olate (CAS 1797817-35-6) is a chemical compound with the molecular formula C4H2N5NaO and a molecular weight of 159.08 g/mol. IUPAC name: sodium 5H-imidazo[4,5-d]triazin-4-olate. InChIKey: NSBYVSIZRFNAOM-UHFFFAOYSA-M.
| Molecular formula | C4H2N5NaO |
|---|---|
| Molecular weight | 159.08 g/mol |
| IUPAC name | sodium 5H-imidazo[4,5-d]triazin-4-olate |
| InChIKey | NSBYVSIZRFNAOM-UHFFFAOYSA-M |
| SMILES | C1=NC2=C(N1)C(=NN=N2)[O-].[Na+] |
Computed by PubChem (NCBI)