Products 1797879-37-8

CAS 1797879-37-8 appears in our catalog under these names: Benzydamine EP Impurity B (5-Benzyl Benzydamine), Benzydamine Impurity 2 (Benzydamine EP Impurity B ). Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

3-(1,5-dibenzylindazol-3-yl)oxy-N,N-dimethylpropan-1-amine;hydrochloride (CAS 1797879-37-8) is a chemical compound with the molecular formula C26H30ClN3O and a molecular weight of 436.0 g/mol. IUPAC name: 3-(1,5-dibenzylindazol-3-yl)oxy-N,N-dimethylpropan-1-amine;hydrochloride. InChIKey: LHILUQKQKYJDKG-UHFFFAOYSA-N.

Identity
Molecular formulaC26H30ClN3O
Molecular weight436.0 g/mol
IUPAC name3-(1,5-dibenzylindazol-3-yl)oxy-N,N-dimethylpropan-1-amine;hydrochloride
InChIKeyLHILUQKQKYJDKG-UHFFFAOYSA-N
SMILESCN(C)CCCOC1=NN(C2=C1C=C(C=C2)CC3=CC=CC=C3)CC4=CC=CC=C4.Cl

Computed by PubChem (NCBI)