CAS 1797884-40-2 is the registry number for Thyroxine Aminopropyl Ether. Offered by: TRC. Available pack sizes: 100mg.
(2S)-2-amino-3-[4-[4-(3-aminopropoxy)-3,5-diiodophenoxy]-3,5-diiodophenyl]propanoic acid (CAS 1797884-40-2) is a chemical compound with the molecular formula C18H18I4N2O4 and a molecular weight of 834.0 g/mol. IUPAC name: (2S)-2-amino-3-[4-[4-(3-aminopropoxy)-3,5-diiodophenoxy]-3,5-diiodophenyl]propanoic acid. InChIKey: LKBFZRCWERFDDM-HNNXBMFYSA-N.
| Molecular formula | C18H18I4N2O4 |
|---|---|
| Molecular weight | 834.0 g/mol |
| IUPAC name | (2S)-2-amino-3-[4-[4-(3-aminopropoxy)-3,5-diiodophenoxy]-3,5-diiodophenyl]propanoic acid |
| InChIKey | LKBFZRCWERFDDM-HNNXBMFYSA-N |
| SMILES | C1=C(C=C(C(=C1I)OC2=CC(=C(C(=C2)I)OCCCN)I)I)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)