CAS 1797905-42-0 appears in our catalog under these names: Atorvastatin Impurity 87, Atorvastatin Impurity 58, 2-Fluoro-Alpha-(2-methyl-1-oxopropyl)-Gamma-oxo-N,Beta-diphenyl-benzenebutanamide. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 1g, 500mg.
2-[2-(2-fluorophenyl)-2-oxo-1-phenylethyl]-4-methyl-3-oxo-N-phenylpentanamide (CAS 1797905-42-0) is a chemical compound with the molecular formula C26H24FNO3 and a molecular weight of 417.5 g/mol. IUPAC name: 2-[2-(2-fluorophenyl)-2-oxo-1-phenylethyl]-4-methyl-3-oxo-N-phenylpentanamide. InChIKey: XIBJIYKHDMWMDT-UHFFFAOYSA-N.
| Molecular formula | C26H24FNO3 |
|---|---|
| Molecular weight | 417.5 g/mol |
| IUPAC name | 2-[2-(2-fluorophenyl)-2-oxo-1-phenylethyl]-4-methyl-3-oxo-N-phenylpentanamide |
| InChIKey | XIBJIYKHDMWMDT-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)C(C(C1=CC=CC=C1)C(=O)C2=CC=CC=C2F)C(=O)NC3=CC=CC=C3 |
Computed by PubChem (NCBI)