CAS 1797915-56-0 is the registry number for Potassium dimethyl-1,2,4-triazin-3-olate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Potassium 5,6-dimethyl-1,2,4-triazin-3-olate (CAS 1797915-56-0) is a chemical compound with the molecular formula C5H6KN3O and a molecular weight of 163.22 g/mol. IUPAC name: potassium 5,6-dimethyl-1,2,4-triazin-3-olate. InChIKey: DBSJJIQUUJMOGB-UHFFFAOYSA-M.
| Molecular formula | C5H6KN3O |
|---|---|
| Molecular weight | 163.22 g/mol |
| IUPAC name | potassium 5,6-dimethyl-1,2,4-triazin-3-olate |
| InChIKey | DBSJJIQUUJMOGB-UHFFFAOYSA-M |
| SMILES | CC1=C(N=NC(=N1)[O-])C.[K+] |
Computed by PubChem (NCBI)