CAS 1797941-32-2 appears in our catalog under these names: 2-Isopropyl-3-methylbutan-1-amine hydrochloride, 95%, 3-(Azaniumylmethyl)-2,4-dimethylpentane chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg.
(3-methyl-2-propan-2-ylbutyl)azanium chloride (CAS 1797941-32-2) is a chemical compound with the molecular formula C8H20ClN and a molecular weight of 165.70 g/mol. IUPAC name: (3-methyl-2-propan-2-ylbutyl)azanium chloride. InChIKey: MXIWXEIPSLJVAH-UHFFFAOYSA-N.
| Molecular formula | C8H20ClN |
|---|---|
| Molecular weight | 165.70 g/mol |
| IUPAC name | (3-methyl-2-propan-2-ylbutyl)azanium chloride |
| InChIKey | MXIWXEIPSLJVAH-UHFFFAOYSA-N |
| SMILES | CC(C)C(C[NH3+])C(C)C.[Cl-] |
Computed by PubChem (NCBI)