CAS 1797982-02-5 appears in our catalog under these names: Haloperidol Decanoate Impurity 3(Haloperidol Decanoate EP Impurity C), 3-Ethyl Haloperidol Decanoate, >95% (HPLC), 3-Ethyl haloperidol decanoate, 3-Ethyl Haloperidol Decanoate, 95%, 95%, Haloperidol Decanoate EP Impurity C HCl. Offered by: Hubei YoungXin, TRC, Biosynth, Chemat, Chemat Brand. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg, 2mg, 1mg.
[4-(4-chlorophenyl)-1-[4-(3-ethyl-4-fluorophenyl)-4-oxobutyl]piperidin-4-yl] decanoate (CAS 1797982-02-5) is a chemical compound with the molecular formula C33H45ClFNO3 and a molecular weight of 558.2 g/mol. IUPAC name: [4-(4-chlorophenyl)-1-[4-(3-ethyl-4-fluorophenyl)-4-oxobutyl]piperidin-4-yl] decanoate. InChIKey: ODANWSUZWFYXTO-UHFFFAOYSA-N.
| Molecular formula | C33H45ClFNO3 |
|---|---|
| Molecular weight | 558.2 g/mol |
| IUPAC name | [4-(4-chlorophenyl)-1-[4-(3-ethyl-4-fluorophenyl)-4-oxobutyl]piperidin-4-yl] decanoate |
| InChIKey | ODANWSUZWFYXTO-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(=O)OC1(CCN(CC1)CCCC(=O)C2=CC(=C(C=C2)F)CC)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)