CAS 1797982-55-8 is the registry number for O-Demethyl-m-methyl Orphenadrine Citrate Salt. Offered by: TRC. Available pack sizes: 1g.
N,N-dimethyl-2-[(3-methylphenyl)-phenylmethoxy]ethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid (CAS 1797982-55-8) is a chemical compound with the molecular formula C24H31NO8 and a molecular weight of 461.5 g/mol. IUPAC name: N,N-dimethyl-2-[(3-methylphenyl)-phenylmethoxy]ethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid. InChIKey: NSKIZWHYOVUTOD-UHFFFAOYSA-N.
| Molecular formula | C24H31NO8 |
|---|---|
| Molecular weight | 461.5 g/mol |
| IUPAC name | N,N-dimethyl-2-[(3-methylphenyl)-phenylmethoxy]ethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid |
| InChIKey | NSKIZWHYOVUTOD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(C2=CC=CC=C2)OCCN(C)C.C(C(=O)O)C(CC(=O)O)(C(=O)O)O |
Computed by PubChem (NCBI)