CAS 1797982-74-1 appears in our catalog under these names: Pemetrexed Impurity 46, Pemetrexed Impurity 71, N-(4-(3-(2,6-Diamino-1,4-dihydro-4-oxo-5-pyrimidinyl)-3-oxopropyl)benzoic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg, 50mg.
Methyl 4-[3-(2,4-diamino-6-oxo-1H-pyrimidin-5-yl)-3-oxopropyl]benzoate (CAS 1797982-74-1) is a chemical compound with the molecular formula C15H16N4O4 and a molecular weight of 316.31 g/mol. IUPAC name: methyl 4-[3-(2,4-diamino-6-oxo-1H-pyrimidin-5-yl)-3-oxopropyl]benzoate. InChIKey: YDYZXSXSUYUFOT-UHFFFAOYSA-N.
| Molecular formula | C15H16N4O4 |
|---|---|
| Molecular weight | 316.31 g/mol |
| IUPAC name | methyl 4-[3-(2,4-diamino-6-oxo-1H-pyrimidin-5-yl)-3-oxopropyl]benzoate |
| InChIKey | YDYZXSXSUYUFOT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)CCC(=O)C2=C(N=C(NC2=O)N)N |
Computed by PubChem (NCBI)