CAS 1798003-45-8 appears in our catalog under these names: tert-Butyl N-((3-bromo-2-hydroxyphenyl)methyl)-N-methylcarbamate, 95%, tert-Butyl N-((3-bromo-2-hydroxyphenyl)methyl)-N-methylcarbamate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Tert-butyl N-[(3-bromo-2-hydroxyphenyl)methyl]-N-methylcarbamate (CAS 1798003-45-8) is a chemical compound with the molecular formula C13H18BrNO3 and a molecular weight of 316.19 g/mol. IUPAC name: tert-butyl N-[(3-bromo-2-hydroxyphenyl)methyl]-N-methylcarbamate. InChIKey: XCNBUZVNYGAUFM-UHFFFAOYSA-N.
| Molecular formula | C13H18BrNO3 |
|---|---|
| Molecular weight | 316.19 g/mol |
| IUPAC name | tert-butyl N-[(3-bromo-2-hydroxyphenyl)methyl]-N-methylcarbamate |
| InChIKey | XCNBUZVNYGAUFM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)CC1=C(C(=CC=C1)Br)O |
Computed by PubChem (NCBI)