Products 1798043-12-5

CAS 1798043-12-5 is the registry number for 3-Benzyloxy-2-bromo-9H-carbazole N-Carboxylic Acid tert-Butyl Ester. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg, 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl 2-bromo-3-phenylmethoxycarbazole-9-carboxylate (CAS 1798043-12-5) is a chemical compound with the molecular formula C24H22BrNO3 and a molecular weight of 452.3 g/mol. IUPAC name: tert-butyl 2-bromo-3-phenylmethoxycarbazole-9-carboxylate. InChIKey: WCTHIWVZXJEDFL-UHFFFAOYSA-N.

Identity
Molecular formulaC24H22BrNO3
Molecular weight452.3 g/mol
IUPAC nametert-butyl 2-bromo-3-phenylmethoxycarbazole-9-carboxylate
InChIKeyWCTHIWVZXJEDFL-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1C2=CC=CC=C2C3=CC(=C(C=C31)Br)OCC4=CC=CC=C4

Computed by PubChem (NCBI)