CAS 179811-74-6 appears in our catalog under these names: 2-Amino-2-(4-phenylphenyl)ethan-1-ol, 95%, 2-Amino-2-(4-phenylphenyl)ethan-1-ol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 10g, 0,5g, 50mg.
2-amino-2-(4-phenylphenyl)ethanol (CAS 179811-74-6) is a chemical compound with the molecular formula C14H15NO and a molecular weight of 213.27 g/mol. IUPAC name: 2-amino-2-(4-phenylphenyl)ethanol. InChIKey: DRGRSSFCCDTWRF-UHFFFAOYSA-N.
| Molecular formula | C14H15NO |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | 2-amino-2-(4-phenylphenyl)ethanol |
| InChIKey | DRGRSSFCCDTWRF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(CO)N |
Computed by PubChem (NCBI)