Products 1798428-35-9

CAS 1798428-35-9 is the registry number for (2Z)-3-Methyl-4-(benzyloxy)-2-buten-1-ol 1-Phosphate Dimethyl Diester. Offered by: TRC. Available pack sizes: 100mg, 10mg.

Structural formula: {0} (CAS {1})

Dimethyl [(Z)-3-methyl-4-phenylmethoxybut-2-enyl] phosphate (CAS 1798428-35-9) is a chemical compound with the molecular formula C14H21O5P and a molecular weight of 300.29 g/mol. IUPAC name: dimethyl [(Z)-3-methyl-4-phenylmethoxybut-2-enyl] phosphate. InChIKey: LATUYHVLPBDHLV-LCYFTJDESA-N.

Identity
Molecular formulaC14H21O5P
Molecular weight300.29 g/mol
IUPAC namedimethyl [(Z)-3-methyl-4-phenylmethoxybut-2-enyl] phosphate
InChIKeyLATUYHVLPBDHLV-LCYFTJDESA-N
SMILESC/C(=C/COP(=O)(OC)OC)/COCC1=CC=CC=C1

Computed by PubChem (NCBI)