CAS 1798429-38-5 appears in our catalog under these names: 3-FMAP Hydrazone Impurity, 4(N’-(1-(3-Fluoro-4-methoxy-phenyl)-ethylidene)hydrazino}benzenesulfonamide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
4-[2-[1-(3-fluoro-4-methoxyphenyl)ethylidene]hydrazinyl]benzenesulfonamide (CAS 1798429-38-5) is a chemical compound with the molecular formula C15H16FN3O3S and a molecular weight of 337.4 g/mol. IUPAC name: 4-[2-[1-(3-fluoro-4-methoxyphenyl)ethylidene]hydrazinyl]benzenesulfonamide. InChIKey: LAQYUSOWMGBOET-UHFFFAOYSA-N.
| Molecular formula | C15H16FN3O3S |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | 4-[2-[1-(3-fluoro-4-methoxyphenyl)ethylidene]hydrazinyl]benzenesulfonamide |
| InChIKey | LAQYUSOWMGBOET-UHFFFAOYSA-N |
| SMILES | CC(=NNC1=CC=C(C=C1)S(=O)(=O)N)C2=CC(=C(C=C2)OC)F |
Computed by PubChem (NCBI)