CAS 1798429-54-5 is the registry number for Istradefylline M8. Offered by: TRC. Available pack sizes: 75mg.
8-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-3-ethyl-1-(2-hydroxyethyl)-7-methylpurine-2,6-dione (CAS 1798429-54-5) is a chemical compound with the molecular formula C20H24N4O5 and a molecular weight of 400.4 g/mol. IUPAC name: 8-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-3-ethyl-1-(2-hydroxyethyl)-7-methylpurine-2,6-dione. InChIKey: CUDODEWTTVIQNG-VQHVLOKHSA-N.
| Molecular formula | C20H24N4O5 |
|---|---|
| Molecular weight | 400.4 g/mol |
| IUPAC name | 8-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-3-ethyl-1-(2-hydroxyethyl)-7-methylpurine-2,6-dione |
| InChIKey | CUDODEWTTVIQNG-VQHVLOKHSA-N |
| SMILES | CCN1C2=C(C(=O)N(C1=O)CCO)N(C(=N2)/C=C/C3=CC(=C(C=C3)OC)OC)C |
Computed by PubChem (NCBI)