CAS 1798724-58-9 appears in our catalog under these names: 3-(3,4-Dichlorophenyl)-3-(morpholin-4-yl)propanoic acid hydrochloride, 95%, 3-(3,4-Dichlorophenyl)-3-(morpholin-4-yl)propanoic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-(3,4-dichlorophenyl)-3-morpholin-4-ylpropanoic acid;hydrochloride (CAS 1798724-58-9) is a chemical compound with the molecular formula C13H16Cl3NO3 and a molecular weight of 340.6 g/mol. IUPAC name: 3-(3,4-dichlorophenyl)-3-morpholin-4-ylpropanoic acid;hydrochloride. InChIKey: ZXCTZKXABWEZQE-UHFFFAOYSA-N.
| Molecular formula | C13H16Cl3NO3 |
|---|---|
| Molecular weight | 340.6 g/mol |
| IUPAC name | 3-(3,4-dichlorophenyl)-3-morpholin-4-ylpropanoic acid;hydrochloride |
| InChIKey | ZXCTZKXABWEZQE-UHFFFAOYSA-N |
| SMILES | C1COCCN1C(CC(=O)O)C2=CC(=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)