CAS 1798725-72-0 appears in our catalog under these names: 1-(3-Chloro-4-fluorophenyl)-2,2,2-trifluoroethan-1-amine hydrochloride, 95%, 1-(3-Chloro-4-fluorophenyl)-2,2,2-trifluoroethan-1-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-(3-chloro-4-fluorophenyl)-2,2,2-trifluoroethanamine;hydrochloride (CAS 1798725-72-0) is a chemical compound with the molecular formula C8H7Cl2F4N and a molecular weight of 264.04 g/mol. IUPAC name: 1-(3-chloro-4-fluorophenyl)-2,2,2-trifluoroethanamine;hydrochloride. InChIKey: OERCSHIAHLZAHM-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2F4N |
|---|---|
| Molecular weight | 264.04 g/mol |
| IUPAC name | 1-(3-chloro-4-fluorophenyl)-2,2,2-trifluoroethanamine;hydrochloride |
| InChIKey | OERCSHIAHLZAHM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(C(F)(F)F)N)Cl)F.Cl |
Computed by PubChem (NCBI)