Products 1798770-47-4

CAS 1798770-47-4 is the registry number for 1-Methyl-1H-pyrazole-4-sulfonic acid. Offered by: Biosynth. Available pack sizes: 100mg, 500mg, 250mg, 1000mg, 2500mg.

Structural formula: {0} (CAS {1})

1-methylpyrazole-4-sulfonic acid (CAS 1798770-47-4) is a chemical compound with the molecular formula C4H6N2O3S and a molecular weight of 162.17 g/mol. IUPAC name: 1-methylpyrazole-4-sulfonic acid. InChIKey: WHYASBKVZHKQTN-UHFFFAOYSA-N.

Identity
Molecular formulaC4H6N2O3S
Molecular weight162.17 g/mol
IUPAC name1-methylpyrazole-4-sulfonic acid
InChIKeyWHYASBKVZHKQTN-UHFFFAOYSA-N
SMILESCN1C=C(C=N1)S(=O)(=O)O

Computed by PubChem (NCBI)