CAS 1798887-66-7 is the registry number for LY 368962 Dimethyl Ester. Offered by: TRC. Available pack sizes: 100mg, 10mg.
Dimethyl (2S)-2-[[4-[3-(2,4-diamino-6-oxo-1H-pyrimidin-5-yl)-3-oxopropyl]benzoyl]amino]pentanedioate (CAS 1798887-66-7) is a chemical compound with the molecular formula C21H25N5O7 and a molecular weight of 459.5 g/mol. IUPAC name: dimethyl (2S)-2-[[4-[3-(2,4-diamino-6-oxo-1H-pyrimidin-5-yl)-3-oxopropyl]benzoyl]amino]pentanedioate. InChIKey: DIPRZQWTSAXGQU-ZDUSSCGKSA-N.
| Molecular formula | C21H25N5O7 |
|---|---|
| Molecular weight | 459.5 g/mol |
| IUPAC name | dimethyl (2S)-2-[[4-[3-(2,4-diamino-6-oxo-1H-pyrimidin-5-yl)-3-oxopropyl]benzoyl]amino]pentanedioate |
| InChIKey | DIPRZQWTSAXGQU-ZDUSSCGKSA-N |
| SMILES | COC(=O)CC[C@@H](C(=O)OC)NC(=O)C1=CC=C(C=C1)CCC(=O)C2=C(N=C(NC2=O)N)N |
Computed by PubChem (NCBI)