CAS 1798887-69-0 is the registry number for (S)-N-Desmethyl Duloxetine Hydrochloride. Offered by: TRC. Available pack sizes: 1g.
(3S)-3-naphthalen-1-yloxy-3-thiophen-2-ylpropan-1-amine;hydrochloride (CAS 1798887-69-0) is a chemical compound with the molecular formula C17H18ClNOS and a molecular weight of 319.8 g/mol. IUPAC name: (3S)-3-naphthalen-1-yloxy-3-thiophen-2-ylpropan-1-amine;hydrochloride. InChIKey: UOABSLFXETYYQW-NTISSMGPSA-N.
| Molecular formula | C17H18ClNOS |
|---|---|
| Molecular weight | 319.8 g/mol |
| IUPAC name | (3S)-3-naphthalen-1-yloxy-3-thiophen-2-ylpropan-1-amine;hydrochloride |
| InChIKey | UOABSLFXETYYQW-NTISSMGPSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2O[C@@H](CCN)C3=CC=CS3.Cl |
Computed by PubChem (NCBI)